ChemNet > CAS > 170880-96-3 2-Fluorophenylglyoxal hydrate
170880-96-3 2-Fluorophenylglyoxal hydrate
상품명칭 |
2-Fluorophenylglyoxal hydrate |
별명 |
(2-fluorophenyl)(oxo)acetaldehyde hydrate; 2-(2-fluorophenyl)-2-oxoacetaldehyde |
분자식 |
C8H7FO3 |
분자량 |
170.1378 |
InChI |
InChI=1/C8H5FO2.H2O/c9-7-4-2-1-3-6(7)8(11)5-10;/h1-5H;1H2 |
cas번호 |
170880-96-3 |
분자 구조 |
|
비등점 |
212.8°C at 760 mmHg |
인화점 |
79.7°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|