ChemNet > CAS > 175277-98-2 2,4-Dichloro-6-methylbenzonitrile
175277-98-2 2,4-Dichloro-6-methylbenzonitrile
| 상품명칭 |
2,4-Dichloro-6-methylbenzonitrile |
| 별명 |
4,6-Dichloro-o-tolunitrile |
| 분자식 |
C8H5Cl2N |
| 분자량 |
186.038 |
| InChI |
InChI=1/C8H5Cl2N/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,1H3 |
| cas번호 |
175277-98-2 |
| 분자 구조 |
|
| 밀도 |
1.34g/cm3 |
| 비등점 |
287°C at 760 mmHg |
| 굴절 지수 |
1.572 |
| 인화점 |
124.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
