ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
상품명칭 |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
별명 |
3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
분자식 |
C8H11ClO |
분자량 |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
cas번호 |
17530-69-7 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
비등점 |
217.7°C at 760 mmHg |
굴절 지수 |
1.488 |
인화점 |
104.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|