ChemNet > CAS > 179113-89-4 3,5-difluorobenzophenone
179113-89-4 3,5-difluorobenzophenone
| 상품명칭 |
3,5-difluorobenzophenone |
| 별명 |
(3,5-difluorophenyl)(phenyl)methanone |
| 분자식 |
C13H8F2O |
| 분자량 |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h1-8H |
| cas번호 |
179113-89-4 |
| 분자 구조 |
|
| 밀도 |
1.239g/cm3 |
| 녹는 점 |
57-59℃ |
| 비등점 |
310°C at 760 mmHg |
| 굴절 지수 |
1.549 |
| 인화점 |
118.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
