ChemNet > CAS > 18622-23-6 4-Biphenylcarboxylic acid hydrazide
18622-23-6 4-Biphenylcarboxylic acid hydrazide
상품명칭 |
4-Biphenylcarboxylic acid hydrazide |
별명 |
4-Phenylbenzhydrazide; biphenyl-4-carbohydrazide |
분자식 |
C13H12N2O |
분자량 |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-15-13(16)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,14H2,(H,15,16) |
cas번호 |
18622-23-6 |
EC번호 |
242-451-8 |
분자 구조 |
|
밀도 |
1.164g/cm3 |
굴절 지수 |
1.612 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|