ChemNet > CAS > 1874-62-0 3-ethoxy-1,2-propanediol
1874-62-0 3-ethoxy-1,2-propanediol
상품명칭 |
3-ethoxy-1,2-propanediol |
별명 |
1,2-Propanediol, 3-ethoxy-; 1-Ethoxy-2,3-propanediol; 3-Ethoxy-1,2-propanediol; BRN 1734312; Glycerol 1-ethyl ether; Glycerol alpha-ethyl ether; Glycerol alpha-monoethyl ether; NSC 227880; alpha-Ethyl glycerol ether; 3-Ethoxypropane-1,2-diol |
분자식 |
C5H12O3 |
분자량 |
120.147 |
InChI |
InChI=1/C5H12O3/c1-2-8-4-5(7)3-6/h5-7H,2-4H2,1H3 |
cas번호 |
1874-62-0 |
EC번호 |
217-503-8 |
분자 구조 |
|
밀도 |
1.064g/cm3 |
비등점 |
241°C at 760 mmHg |
굴절 지수 |
1.444 |
인화점 |
99.5°C |
위험성 표시 |
|
리스크 규칙 |
R36:Irritating to eyes.;
|
보안 규칙 |
S24:Avoid contact with skin.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|