ChemNet > CAS > 19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
상품명칭 |
Ethyl 4-hydroxy-3-nitrobenzoate |
별명 |
4-Hydroxy-3-nitrobenzoic acid ethyl ester |
분자식 |
C9H9NO5 |
분자량 |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-2-15-9(12)6-3-4-8(11)7(5-6)10(13)14/h3-5,11H,2H2,1H3 |
cas번호 |
19013-10-6 |
EC번호 |
242-751-9 |
분자 구조 |
|
밀도 |
1.37g/cm3 |
비등점 |
323.5°C at 760 mmHg |
굴절 지수 |
1.577 |
인화점 |
149.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|