ChemNet > CAS > 190661-29-1 (2-Benzyloxyphenyl)boronic acid
190661-29-1 (2-Benzyloxyphenyl)boronic acid
| 상품명칭 |
(2-Benzyloxyphenyl)boronic acid |
| 별명 |
2-Benzyloxyphenylboronic acid; 2-Benzyloxybenzeneboronic acid; 2-Phenylmethoxy Phenylboronic Acid |
| 분자식 |
C13H13BO3 |
| 분자량 |
228.0515 |
| InChI |
InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2 |
| cas번호 |
190661-29-1 |
| 분자 구조 |
|
| 밀도 |
1.2g/cm3 |
| 녹는 점 |
105-110℃ |
| 비등점 |
428.7°C at 760 mmHg |
| 굴절 지수 |
1.593 |
| 인화점 |
213°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
