ChemNet > CAS > 19347-73-0 6-Chlorohexanoyl chloride
19347-73-0 6-Chlorohexanoyl chloride
| 상품명칭 |
6-Chlorohexanoyl chloride |
| 별명 |
6-Chlorocaproyl chloride |
| 분자식 |
C6H10Cl2O |
| 분자량 |
169.049 |
| InChI |
InChI=1/C6H10Cl2O/c7-5-3-1-2-4-6(8)9/h1-5H2 |
| cas번호 |
19347-73-0 |
| EC번호 |
242-979-9 |
| 분자 구조 |
|
| 밀도 |
1.146g/cm3 |
| 비등점 |
204.8°C at 760 mmHg |
| 굴절 지수 |
1.449 |
| 인화점 |
82.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
