ChemNet > CAS > 1968-40-7 Ethyl pent-4-enoate
1968-40-7 Ethyl pent-4-enoate
| 상품명칭 |
Ethyl pent-4-enoate |
| 별명 |
Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
| 분자식 |
C7H12O2 |
| 분자량 |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
| cas번호 |
1968-40-7 |
| EC번호 |
217-818-0 |
| 분자 구조 |
|
| 밀도 |
0.898g/cm3 |
| 비등점 |
122.8°C at 760 mmHg |
| 굴절 지수 |
1.418 |
| 인화점 |
33.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
