ChemNet > CAS > 19806-17-8 1,3-Phenylenediacetic acid
19806-17-8 1,3-Phenylenediacetic acid
상품명칭 |
1,3-Phenylenediacetic acid |
별명 |
m-Phenylendiacetic acid; Benzene-1,3-diacetic acid; 1,3-Bis-(carboxymethyl)-benzene; 2,2'-benzene-1,2-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetate |
분자식 |
C10H8O4 |
분자량 |
192.1692 |
InChI |
InChI=1/C10H10O4/c11-9(12)5-7-2-1-3-8(4-7)6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14)/p-2 |
cas번호 |
19806-17-8 |
EC번호 |
243-332-3 |
분자 구조 |
|
녹는 점 |
173-177℃ |
비등점 |
408.6°C at 760 mmHg |
인화점 |
215.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|