ChemNet > CAS > 20469-63-0 Dimethoxyiodobenzene
20469-63-0 Dimethoxyiodobenzene
| 상품명칭 |
Dimethoxyiodobenzene |
| 별명 |
1,3-Dimethoxy-4-iodobenzene; 1-Iodo-2,4-dimethoxybenzene; Benzene, 1-iodo-2,4-dimethoxy-; 2,4-Dimethoxyiodobenzene |
| 분자식 |
C8H9IO2 |
| 분자량 |
264.0603 |
| InChI |
InChI=1/C8H9IO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| cas번호 |
20469-63-0 |
| 분자 구조 |
|
| 밀도 |
1.655g/cm3 |
| 녹는 점 |
37-41℃ |
| 비등점 |
284.3°C at 760 mmHg |
| 굴절 지수 |
1.572 |
| 인화점 |
125.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
