ChemNet > CAS > 206551-43-1 5-Acetylthiophene-2-boronic acid
206551-43-1 5-Acetylthiophene-2-boronic acid
| 상품명칭 |
5-Acetylthiophene-2-boronic acid |
| 별명 |
(5-acetylthiophen-2-yl)boronic acid; 5-Acetyl-2-thiopheneboronic acid; 2-Acetylthiphene-2-boronic acid; 2-ACETYLTHIOPHENE-5-BORONIC ACID; 5-Acetyl-2-thienylboronicAcid; 5-Acetylthiophen-2-Ylboronic Acid |
| 분자식 |
C6H7BO3S |
| 분자량 |
169.994 |
| InChI |
InChI=1/C6H7BO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3,9-10H,1H3 |
| cas번호 |
206551-43-1 |
| 분자 구조 |
|
| 밀도 |
1.34g/cm3 |
| 녹는 점 |
133-138℃ |
| 비등점 |
399.3°C at 760 mmHg |
| 굴절 지수 |
1.556 |
| 인화점 |
195.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
