ChemNet > CAS > 21055-37-8 Methyl 2-isothiocyanatoacetate
21055-37-8 Methyl 2-isothiocyanatoacetate
상품명칭 |
Methyl 2-isothiocyanatoacetate |
별명 |
2-Isothiocyanatoacetic acid methyl ester; thyl 2-isothiocyanatoacetate; methyl N-(thioxomethylidene)glycinate |
분자식 |
C4H5NO2S |
분자량 |
131.153 |
InChI |
InChI=1/C4H5NO2S/c1-7-4(6)2-5-3-8/h2H2,1H3 |
cas번호 |
21055-37-8 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
비등점 |
193.9°C at 760 mmHg |
굴절 지수 |
1.503 |
인화점 |
71.1°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|