ChemNet > CAS > 21860-84-4 2-Phthalimidopropionic acid
21860-84-4 2-Phthalimidopropionic acid
상품명칭 |
2-Phthalimidopropionic acid |
별명 |
Phthaloylalanine; Phthaloyl-DL-alanine; N-Phthaloyl-DL-alanine; 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid |
분자식 |
C11H9NO4 |
분자량 |
219.19 |
InChI |
InChI=1/C11H9NO4/c1-6(11(15)16)12-9(13)7-4-2-3-5-8(7)10(12)14/h2-6H,1H3,(H,15,16) |
cas번호 |
21860-84-4 |
분자 구조 |
|
녹는 점 |
149-151℃ |
위험성 표시 |
Xi :;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|