ChemNet > CAS > 23163-84-0 2-ethoxyphenyl isothiocyanate
23163-84-0 2-ethoxyphenyl isothiocyanate
| 상품명칭 |
2-ethoxyphenyl isothiocyanate |
| 별명 |
o-Ethoxyphenyl isothiocyanate; 1-ethoxy-2-isothiocyanatobenzene |
| 분자식 |
C9H9NOS |
| 분자량 |
179.2389 |
| InChI |
InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| cas번호 |
23163-84-0 |
| EC번호 |
245-468-9 |
| 분자 구조 |
|
| 밀도 |
1.06g/cm3 |
| 비등점 |
293.2°C at 760 mmHg |
| 굴절 지수 |
1.544 |
| 인화점 |
131.1°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
