ChemNet > CAS > 23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
| 상품명칭 |
1-Benzyl-4-(ethoxycarbonylmethyl)piperazine |
| 별명 |
N-Benzyl-N-(carboethoxymethyl)piperazine; ethyl (4-benzylpiperazin-1-yl)acetate; ethyl 2-(4-benzylpiperazin-1-yl)acetate |
| 분자식 |
C15H22N2O2 |
| 분자량 |
262.3474 |
| InChI |
InChI=1/C15H22N2O2/c1-2-19-15(18)13-17-10-8-16(9-11-17)12-14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3 |
| cas번호 |
23173-76-4 |
| 분자 구조 |
|
| 밀도 |
1.088g/cm3 |
| 비등점 |
360.7°C at 760 mmHg |
| 굴절 지수 |
1.535 |
| 인화점 |
172°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
