ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
상품명칭 |
2,3-Difluoro-4-methylbenzoic acid |
별명 |
2,3-Difluoro-p-toluic acid |
분자식 |
C8H6F2O2 |
분자량 |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
cas번호 |
261763-37-5 |
분자 구조 |
|
밀도 |
1.359g/cm3 |
비등점 |
274°C at 760 mmHg |
굴절 지수 |
1.511 |
인화점 |
119.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|