ChemNet > CAS > 27193-86-8 4-Dodecylphenol, mixture of isomers
27193-86-8 4-Dodecylphenol, mixture of isomers
상품명칭 |
4-Dodecylphenol, mixture of isomers |
별명 |
Dodecylphenol, mixture of isomers; 2-dodecylphenol |
분자식 |
C18H30O |
분자량 |
262.4302 |
InChI |
InChI=1/C18H30O/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19/h12-13,15-16,19H,2-11,14H2,1H3 |
cas번호 |
27193-86-8 |
EC번호 |
248-312-8 |
분자 구조 |
|
밀도 |
0.918g/cm3 |
비등점 |
368.3°C at 760 mmHg |
굴절 지수 |
1.499 |
인화점 |
210.8°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|