ChemNet > CAS > 2998-04-1 Diallyl adipate
2998-04-1 Diallyl adipate
| 상품명칭 |
Diallyl adipate |
| 별명 |
Diallyl adipate, (Adipic acid diallyl ester); Adipic acid diallyl ester; diprop-2-en-1-yl hexanedioate |
| 분자식 |
C12H18O4 |
| 분자량 |
226.2689 |
| InChI |
InChI=1/C12H18O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-4H,1-2,5-10H2 |
| cas번호 |
2998-04-1 |
| EC번호 |
221-071-6 |
| 분자 구조 |
|
| 밀도 |
1.011g/cm3 |
| 비등점 |
288.4°C at 760 mmHg |
| 굴절 지수 |
1.454 |
| 인화점 |
133.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
