ChemNet > CAS > 306-37-6 sym-Dimethylhydrazine dihydrochloride
306-37-6 sym-Dimethylhydrazine dihydrochloride
| 상품명칭 |
sym-Dimethylhydrazine dihydrochloride |
| 별명 |
1,2-Dimethylhydrazine dihydrochloride; 1,2-dimethylhydrazine; 1,1-dimethylhydrazine dihydrochloride |
| 분자식 |
C2H10Cl2N2 |
| 분자량 |
133.0202 |
| InChI |
InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
| cas번호 |
306-37-6 |
| EC번호 |
206-183-5 |
| 분자 구조 |
|
| 녹는 점 |
166-167℃ |
| 비등점 |
63.9°C at 760 mmHg |
| 인화점 |
1.1°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
