ChemNet > CAS > 31377-23-8 1-Adamantanamine sulfate
31377-23-8 1-Adamantanamine sulfate
| 상품명칭 |
1-Adamantanamine sulfate |
| 별명 |
1-Aminoadamantansulfate; Amantadine Sulphate; Amantadine Sulfate; tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate (2:1); tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate |
| 분자식 |
C10H19NO4S |
| 분자량 |
249.3272 |
| InChI |
InChI=1/C10H17N.H2O4S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-5(2,3)4/h7-9H,1-6,11H2;(H2,1,2,3,4) |
| cas번호 |
31377-23-8 |
| EC번호 |
250-604-5 |
| 분자 구조 |
|
| 녹는 점 |
300℃ |
| 비등점 |
225.7°C at 760 mmHg |
| 인화점 |
96°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
