ChemNet > CAS > 31431-13-7 Cyclobutyl-4-fluorophenyl ketone
31431-13-7 Cyclobutyl-4-fluorophenyl ketone
상품명칭 |
Cyclobutyl-4-fluorophenyl ketone |
별명 |
Cyclobutyl 4-fluorophenyl ketone; cyclobutyl(4-fluorophenyl)methanone |
분자식 |
C11H11FO |
분자량 |
178.2028 |
InChI |
InChI=1/C11H11FO/c12-10-6-4-9(5-7-10)11(13)8-2-1-3-8/h4-8H,1-3H2 |
cas번호 |
31431-13-7 |
EC번호 |
250-628-6 |
분자 구조 |
|
밀도 |
1.17g/cm3 |
비등점 |
268°C at 760 mmHg |
굴절 지수 |
1.544 |
인화점 |
107.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|