CAS No: 33471-33-9, Chemical Name: (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
the physical and chemical property of 33471-33-9, (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone is provided by ChemNet.com
ChemNet > CAS > 33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
33471-33-9 (2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone
상품명칭 |
(2R,3S,5S,6S)-2,3,4,5,6-pentahydroxycyclohexanone |
별명 |
(2R,3S,4S,5S,6S)-2,3,4,5,6-Pentahydroxycyclohexanone; cyclohexanone, 2,3,4,5,6-pentahydroxy-, (2α,3α,4α,5β,6α)- |
분자식 |
C6H10O6 |
분자량 |
178.14 |
InChI |
InChI=1/C6H10O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-5,7-11H/t1-,2-,3-,4+,5-/m0/s1 |
cas번호 |
33471-33-9 |
분자 구조 |
|
밀도 |
2.027g/cm3 |
비등점 |
368.552°C at 760 mmHg |
굴절 지수 |
1.749 |
인화점 |
190.876°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|