ChemNet > CAS > 341-69-5 Orphenadrine hydrochloride
341-69-5 Orphenadrine hydrochloride
| 상품명칭 |
Orphenadrine hydrochloride |
| 별명 |
N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride; N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1); N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium; N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| 분자식 |
C18H24NO |
| 분자량 |
270.3887 |
| InChI |
InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| cas번호 |
341-69-5 |
| EC번호 |
206-435-4 |
| 분자 구조 |
|
| 녹는 점 |
159-162℃ |
| 비등점 |
363°C at 760 mmHg |
| 인화점 |
107.1°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
