ChemNet > CAS > 3431-62-7 3-nitrobenzaldoxime
3431-62-7 3-nitrobenzaldoxime
상품명칭 |
3-nitrobenzaldoxime |
별명 |
3-Nitrobenzaldoxime, (3-Nitrobenzaldehyde oxime); 3-Nitrobenzaldehyde oxime; N-hydroxy-1-(3-nitrophenyl)methanimine |
분자식 |
C7H6N2O3 |
분자량 |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-8-5-6-2-1-3-7(4-6)9(11)12/h1-5,10H/b8-5- |
cas번호 |
3431-62-7 |
분자 구조 |
|
밀도 |
1.33g/cm3 |
녹는 점 |
123-125℃ |
비등점 |
295.2°C at 760 mmHg |
굴절 지수 |
1.589 |
인화점 |
132.3°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|