ChemNet > CAS > 34800-90-3 1-Naphthaleneacethydrazide
34800-90-3 1-Naphthaleneacethydrazide
상품명칭 |
1-Naphthaleneacethydrazide |
별명 |
AKOS BBB/161; AKOS AU36-M591; 2-NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-NAPHTHYL)ACETOHYDRAZIDE; ASISCHEM D13399; NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-Naphthyl)acethydrazide; 2-(naphthalen-1-yl)acetohydrazide |
분자식 |
C12H12N2O |
분자량 |
200.2365 |
InChI |
InChI=1/C12H12N2O/c13-14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,13H2,(H,14,15) |
cas번호 |
34800-90-3 |
분자 구조 |
|
밀도 |
1.206g/cm3 |
비등점 |
466.4°C at 760 mmHg |
굴절 지수 |
1.653 |
인화점 |
235.9°C |
위험성 표시 |
Xi:;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|