ChemNet > CAS > 3538-65-6 Butyric acid hydrazide
3538-65-6 Butyric acid hydrazide
상품명칭 |
Butyric acid hydrazide |
별명 |
Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
분자식 |
C4H10N2O |
분자량 |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
cas번호 |
3538-65-6 |
EC번호 |
222-579-0 |
분자 구조 |
|
밀도 |
0.98g/cm3 |
비등점 |
249.8°C at 760 mmHg |
굴절 지수 |
1.445 |
인화점 |
104.9°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|