ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
상품명칭 |
di(propylene glycol) butyl ether, mixture of |
별명 |
Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
분자식 |
C10H22O3 |
분자량 |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
cas번호 |
35884-42-5 |
EC번호 |
252-776-7 |
분자 구조 |
|
밀도 |
0.931g/cm3 |
비등점 |
221.1°C at 760 mmHg |
굴절 지수 |
1.435 |
인화점 |
87.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|