ChemNet > CAS > 40003-41-6 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid
40003-41-6 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid
상품명칭 |
2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid |
별명 |
2-bromo-4-methylthiazole-5-carboxylic acid |
분자식 |
C5H4BrNO2S |
분자량 |
222.0598 |
InChI |
InChI=1/C5H4BrNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9) |
cas번호 |
40003-41-6 |
분자 구조 |
|
밀도 |
1.895g/cm3 |
녹는 점 |
153℃ |
비등점 |
349.5°C at 760 mmHg |
굴절 지수 |
1.639 |
인화점 |
165.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|