ChemNet > CAS > 4096-21-3 1-Phenylpyrrolidine
4096-21-3 1-Phenylpyrrolidine
상품명칭 |
1-Phenylpyrrolidine |
별명 |
1-phenyl-pyrrolidine |
분자식 |
C10H13N |
분자량 |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
cas번호 |
4096-21-3 |
EC번호 |
223-849-0 |
분자 구조 |
|
밀도 |
1.022g/cm3 |
비등점 |
237.8°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
89°C |
위험성 표시 |
|
리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|