ChemNet > CAS > 43111-32-6 3-Chlorophenoxyacetonitrile
43111-32-6 3-Chlorophenoxyacetonitrile
상품명칭 |
3-Chlorophenoxyacetonitrile |
분자식 |
C8H6ClNO |
분자량 |
167.5923 |
InChI |
InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
cas번호 |
43111-32-6 |
분자 구조 |
|
밀도 |
1.238g/cm3 |
녹는 점 |
30℃ |
비등점 |
279.8°C at 760 mmHg |
굴절 지수 |
1.538 |
인화점 |
123°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|