ChemNet > CAS > 4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
4368-83-6 5-Acetamido-2-nitrobenzoic acid,98%
| 상품명칭 |
5-Acetamido-2-nitrobenzoic acid,98% |
| 별명 |
5-(Acetylamino)-2-nitrobenzoic acid; 5-(acetylamino)-2-nitrobenzoate |
| 분자식 |
C9H7N2O5 |
| 분자량 |
223.1628 |
| InChI |
InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-8(11(15)16)7(4-6)9(13)14/h2-4H,1H3,(H,10,12)(H,13,14)/p-1 |
| cas번호 |
4368-83-6 |
| EC번호 |
224-461-4 |
| 분자 구조 |
|
| 비등점 |
522.9°C at 760 mmHg |
| 인화점 |
270.1°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
