ChemNet > CAS > 455-84-5 4-Fluoro-3-methylbenzoyl chloride
455-84-5 4-Fluoro-3-methylbenzoyl chloride
| 상품명칭 |
4-Fluoro-3-methylbenzoyl chloride |
| 별명 |
4-Fluoro-m-toluoyl chloride |
| 분자식 |
C8H6ClFO |
| 분자량 |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
| cas번호 |
455-84-5 |
| 분자 구조 |
|
| 밀도 |
1.265g/cm3 |
| 비등점 |
214.1°C at 760 mmHg |
| 굴절 지수 |
1.518 |
| 인화점 |
83.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
