ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
| 상품명칭 |
3,4-Dichlorobenzoylacetonitrile |
| 별명 |
3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
| 분자식 |
C9H5Cl2NO |
| 분자량 |
214.0481 |
| InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
| cas번호 |
4640-68-0 |
| 분자 구조 |
|
| 밀도 |
1.383g/cm3 |
| 비등점 |
398.4°C at 760 mmHg |
| 굴절 지수 |
1.567 |
| 인화점 |
194.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
