ChemNet > CAS > 4787-77-3 2-(1-Pyrrolidino)phenol
4787-77-3 2-(1-Pyrrolidino)phenol
상품명칭 |
2-(1-Pyrrolidino)phenol |
별명 |
2-Pyrrolidinophenol, [1-(2-Hydroxyphenyl)pyrrolidine]; 1-(2-Hydroxyphenyl)pyrrolidine; 2-pyrrolidin-1-ylphenol |
분자식 |
C10H13NO |
분자량 |
163.2163 |
InChI |
InChI=1/C10H13NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-2,5-6,12H,3-4,7-8H2 |
cas번호 |
4787-77-3 |
분자 구조 |
|
밀도 |
1.146g/cm3 |
비등점 |
279.1°C at 760 mmHg |
굴절 지수 |
1.594 |
인화점 |
139.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|