CAS No: 502-61-4, Chemical Name: 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
the physical and chemical property of 502-61-4, 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- is provided by ChemNet.com
ChemNet > CAS > 502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
502-61-4 1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)-
상품명칭 |
1,3,6,10-Dodecatetraene-, 3,7,11-trimethyl-,(E,E)- |
별명 |
n-Decyl acrylate; 3,7,11-trimethyldodeca-1,3,6,10-tetraene; (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
분자식 |
C15H24 |
분자량 |
204.3511 |
InChI |
InChI=1/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10+,15-12+ |
cas번호 |
502-61-4 |
EC번호 |
207-948-6 |
분자 구조 |
|
밀도 |
0.812g/cm3 |
비등점 |
279.6°C at 760 mmHg |
굴절 지수 |
1.476 |
인화점 |
113.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|