ChemNet > CAS > 523-31-9 dibenzyl phthalate
523-31-9 dibenzyl phthalate
상품명칭 |
dibenzyl phthalate |
별명 |
Dibenzyl phthalate, (Phthalic acid dibenzyl ester); Phthalic acid dibenzyl ester; dibenzyl benzene-1,3-dicarboxylate |
분자식 |
C22H18O4 |
분자량 |
346.3759 |
InChI |
InChI=1/C22H18O4/c23-21(25-15-17-8-3-1-4-9-17)19-12-7-13-20(14-19)22(24)26-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
cas번호 |
523-31-9 |
EC번호 |
208-344-5 |
분자 구조 |
|
밀도 |
1.208g/cm3 |
비등점 |
493.8°C at 760 mmHg |
굴절 지수 |
1.605 |
인화점 |
248.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|