ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
상품명칭 |
Methyl 3-methoxy-2-nitrobenzoate |
별명 |
3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
분자식 |
C9H9NO5 |
분자량 |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
cas번호 |
5307-17-5 |
분자 구조 |
|
밀도 |
1.294g/cm3 |
비등점 |
325.4°C at 760 mmHg |
굴절 지수 |
1.54 |
인화점 |
151.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|