ChemNet > CAS > 5411-12-1 1,3-Diphenyl-2,3-epoxy-1-propanone
5411-12-1 1,3-Diphenyl-2,3-epoxy-1-propanone
| 상품명칭 |
1,3-Diphenyl-2,3-epoxy-1-propanone |
| 별명 |
Chalcone alpha,beta-epoxide; Benyzlideneacetophenone epoxide~2-Benzoyl-3-phenyloxirane; phenyl(3-phenyloxiran-2-yl)methanone |
| 분자식 |
C15H12O2 |
| 분자량 |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H |
| cas번호 |
5411-12-1 |
| EC번호 |
226-487-1 |
| 분자 구조 |
|
| 밀도 |
1.209g/cm3 |
| 비등점 |
374.1°C at 760 mmHg |
| 굴절 지수 |
1.617 |
| 인화점 |
174°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
