상품명칭 |
D-글루시톨, 에톡실화 및 프로폭실화 (1 - 12.5 몰 에톡실화 및 1 - 12.5 몰 프로폭실화) |
별명 |
폴리옥시에틸렌 (245), 폴리옥시프로필렌 (6), 소르비톨; PPG-6-소르베스-245; PPG-6-소르베스-500; 폴리옥시에틸렌 (500), 폴리옥시프로필렌, (6) 소르비톨; 폴리옥시프로필렌 (6) 폴리옥시에틸렌 (245) 소르비톨; 폴리옥시프로필렌 (6) 폴리옥시에틸렌 (500) 소르비톨; 폴리 (옥시 (메틸 -1,2- 에탄 디일) 옥시 -1,2- 에탄 디일), D- 글루시톨; 옥시란, 2-메틸-, 옥시란이 있는 중합체, D-글루시톨이 있는 에테르(6:1); 옥시란, 메틸-, 옥시란이 있는 중합체, D-글루시톨이 있는 에테르(6:1); (2R, 3R, 4R, 5S)-헥산 -1,2,3,4,5,6- 헥솔; 2-메틸옥시란; 옥시란 |
영문 이름 |
D-Glucitol, ethoxylated and propoxylated (1 - 12.5 moles ethoxylated and 1 - 12.5 moles propoxylated);Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poly(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polymer with oxirane, ether with D-glucitol (6:1); Oxirane, methyl-, polymer with oxirane, ether with D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; oxirane |
분자식 |
C36H74O18 |
분자량 |
794.962 |
InChI |
InChI=1/C6H14O6.6C3H6O.6C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;6*1-3-2-4-3;6*1-2-3-1/h3-12H,1-2H2;6*3H,2H2,1H3;6*1-2H2/t3-,4+,5-,6-;;;;;;;;;;;;/m1............/s1 |
cas번호 |
56449-05-9 |
EC번호 |
500-132-3 |
분자 구조 |
|
비등점 |
494.9°C at 760 mmHg |
인화점 |
292.6°C |
증기압 |
7.22E-12mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|