5667-47-0 디메틸 페나실 설포늄 브로마이드
상품명칭 |
디메틸 페나실 설포늄 브로마이드 |
별명 |
;D이메틸 페나실 설포늄 브로마이드; 디메틸 (2- 옥소 -2- 페닐 에틸) 술포늄 브로마이드; 디메틸 (2- 옥소 -2- 페닐 에틸) 술포늄 |
영문 이름 |
Dimethyl phenacyl sulfonium bromide; Dimethyl phenacyl sulphonium bromide; dimethyl(2-oxo-2-phenylethyl)sulfonium bromide; dimethyl(2-oxo-2-phenylethyl)sulfonium |
분자식 |
C10H13OS |
분자량 |
181.2741 |
InChI |
InChI=1/C10H13OS/c1-12(2)8-10(11)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/q+1 |
cas번호 |
5667-47-0 |
EC번호 |
227-127-6 |
분자 구조 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|