ChemNet > CAS > 575-43-9 1,6-Dimethylnaphthalene
575-43-9 1,6-Dimethylnaphthalene
상품명칭 |
1,6-Dimethylnaphthalene |
별명 |
AI3-17608; HSDB 6024; NSC 52966; Naphthalene, 1,6-dimethyl-; Naphthalene, 1,6-dimethyl- (8CI)(9CI) |
분자식 |
C12H12 |
분자량 |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
cas번호 |
575-43-9 |
EC번호 |
209-385-1 |
분자 구조 |
|
밀도 |
1g/cm3 |
비등점 |
264.4°C at 760 mmHg |
굴절 지수 |
1.604 |
인화점 |
110.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|