6035-71-8 알파-푸릴디옥심 일수화물, I의 혼합물
상품명칭 |
알파-푸릴디옥심 일수화물, I의 혼합물 |
별명 |
; 알파-푸릴 디옥심 일수화물; 알파 Furildioxime, 이성질체 일 수화물의 혼합물; 2,2-Furyldioxime 일수화물 |
영문 이름 |
alpha-furildioxime monohydrate, mixture of I; alpha-Furil dioxime monohydrate; alpha-Furildioxime,mixture of isomers monohydrate; 2,2-Furyldioxime monohydrate |
분자식 |
C10H10N2O5 |
분자량 |
238.1968 |
InChI |
InChI=1/C10H8N2O4.H2O/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8;/h1-6,11,13H;1H2/b10-9+; |
cas번호 |
6035-71-8 |
분자 구조 |
|
녹는 점 |
166-168℃ |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|