ChemNet > CAS > 622-46-8 Phenyl carbamate
622-46-8 Phenyl carbamate
상품명칭 |
Phenyl carbamate |
별명 |
AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
분자식 |
C7H7NO2 |
분자량 |
137.136 |
InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
cas번호 |
622-46-8 |
EC번호 |
210-737-1 |
분자 구조 |
|
밀도 |
1.2g/cm3 |
녹는 점 |
145-152℃ |
비등점 |
278.9°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
159.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|