ChemNet > CAS > 637-53-6 Thioacetanilide
637-53-6 Thioacetanilide
상품명칭 |
Thioacetanilide |
별명 |
98%; THIOACETANILIDE 99%; N-phenylethanethioamide |
분자식 |
C8H9NS |
분자량 |
151.2288 |
InChI |
InChI=1/C8H9NS/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
cas번호 |
637-53-6 |
EC번호 |
211-288-4 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
녹는 점 |
76-79℃ |
비등점 |
225.121°C at 760 mmHg |
굴절 지수 |
1.654 |
인화점 |
89.95°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|