ChemNet > CAS > 6496-89-5 2,4-Dimethoxyphenylacetic acid
6496-89-5 2,4-Dimethoxyphenylacetic acid
상품명칭 |
2,4-Dimethoxyphenylacetic acid |
별명 |
(2,4-dimethoxyphenyl)acetate |
분자식 |
C10H12O4 |
분자량 |
195.1925 |
InChI |
InChI=1/C10H12O4/c1-13-8-4-3-7(5-10(11)12)9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)/p-1 |
cas번호 |
6496-89-5 |
분자 구조 |
|
녹는 점 |
110-113℃ |
비등점 |
339.7°C at 760 mmHg |
인화점 |
134.1°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|