ChemNet > CAS > 6590-94-9 3,4-Dichlorophenyl isothiocyanate
6590-94-9 3,4-Dichlorophenyl isothiocyanate
상품명칭 |
3,4-Dichlorophenyl isothiocyanate |
별명 |
3,4-Dichloroisothiocyanatobenzene; 1,2-dichloro-4-isothiocyanatobenzene |
분자식 |
C7H3Cl2NS |
분자량 |
204.0764 |
InChI |
InChI=1/C7H3Cl2NS/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
cas번호 |
6590-94-9 |
EC번호 |
229-526-0 |
분자 구조 |
|
밀도 |
1.37g/cm3 |
비등점 |
297.8°C at 760 mmHg |
굴절 지수 |
1.614 |
인화점 |
133.9°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|