ChemNet > CAS > 6590-97-2 2,3-Dichloroisothiocyanatobenzene
6590-97-2 2,3-Dichloroisothiocyanatobenzene
| 상품명칭 |
2,3-Dichloroisothiocyanatobenzene |
| 분자식 |
C7H3Cl2NS |
| 분자량 |
204.0764 |
| InChI |
InChI=1/C7H3Cl2NS/c8-5-2-1-3-6(7(5)9)10-4-11/h1-3H |
| cas번호 |
6590-97-2 |
| 분자 구조 |
|
| 밀도 |
1.37g/cm3 |
| 비등점 |
311.3°C at 760 mmHg |
| 굴절 지수 |
1.614 |
| 인화점 |
142.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
