ChemNet > CAS > 66424-91-7 5-Methyl-2-nitrobenzyl chloride
66424-91-7 5-Methyl-2-nitrobenzyl chloride
| 상품명칭 |
5-Methyl-2-nitrobenzyl chloride |
| 별명 |
alpha-chloro-5-methyl-2-nitrotoluene; 2-(chloromethyl)-4-methyl-1-nitrobenzene |
| 분자식 |
C8H8ClNO2 |
| 분자량 |
185.6076 |
| InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
| cas번호 |
66424-91-7 |
| EC번호 |
266-359-2 |
| 분자 구조 |
|
| 밀도 |
1.277g/cm3 |
| 녹는 점 |
41-43℃ |
| 비등점 |
292.3°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
130.6°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
